C18H41NOSn — CID 22757043
N,N-diethyl-1-tributylstannyloxyethanamine (PubChem CID 22757043) has the molecular formula C18H41NOSn and a molecular weight of 406.24 g/mol. Its IUPAC name is N,N-diethyl-1-tributylstannyloxyethanamine.
| Compound Name | N,N-diethyl-1-tributylstannyloxyethanamine |
|---|---|
| PubChem CID | 22757043 |
| Molecular Formula | C18H41NOSn |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N,N-diethyl-1-tributylstannyloxyethanamine |
| SMILES | CCCC[Sn](CCCC)(CCCC)OC(C)N(CC)CC |
| InChI | InChI=1S/C6H14NO.3C4H9.Sn/c1-4-7(5-2)6(3)8;3*1-3-4-2;/h6H,4-5H2,1-3H3;3*1,3-4H2,2H3;/q-1;;;;+1 |
| InChIKey | JWOLBVKDBJEDTE-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|