C14H23N — CID 22758171
1-(1,2,3,4,5,8-hexahydronaphthalen-1-yl)butan-1-amine (PubChem CID 22758171) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 1-(1,2,3,4,5,8-hexahydronaphthalen-1-yl)butan-1-amine.
| Compound Name | 1-(1,2,3,4,5,8-hexahydronaphthalen-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 22758171 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 1-(1,2,3,4,5,8-hexahydronaphthalen-1-yl)butan-1-amine |
| SMILES | CCCC(N)C1CCCC2=C1CC=CC2 |
| InChI | InChI=1S/C14H23N/c1-2-6-14(15)13-10-5-8-11-7-3-4-9-12(11)13/h3-4,13-14H,2,5-10,15H2,1H3 |
| InChIKey | GKZKCVWESPAECZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|