About 3-ethenylsulfanylpentane
3-ethenylsulfanylpentane (PubChem CID 22770243) has the molecular formula C7H14S
and a molecular weight of 130.26 g/mol. Its IUPAC name is 3-ethenylsulfanylpentane.
Molecular Properties
| Compound Name | 3-ethenylsulfanylpentane |
| PubChem CID | 22770243 |
| Molecular Formula | C7H14S |
| Molecular Weight | 130.26 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 3-ethenylsulfanylpentane |
| SMILES | C=CSC(CC)CC |
| InChI | InChI=1S/C7H14S/c1-4-7(5-2)8-6-3/h6-7H,3-5H2,1-2H3 |
| InChIKey | WSPREZKKYVBACF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenylsulfanylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylsulfanylpentane?
The IUPAC name of 3-ethenylsulfanylpentane (CID 22770243) is 3-ethenylsulfanylpentane.
What is the SMILES notation for 3-ethenylsulfanylpentane?
The canonical SMILES for 3-ethenylsulfanylpentane is C=CSC(CC)CC.
What is the InChIKey of 3-ethenylsulfanylpentane?
The InChIKey is WSPREZKKYVBACF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14S/c1-4-7(5-2)8-6-3/h6-7H,3-5H2,1-2H3.
What are the key properties of 3-ethenylsulfanylpentane?
3-ethenylsulfanylpentane has a molecular weight of 130.26 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylsulfanylpentane is sourced from PubChem (CID 22770243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).