C5H10O2S — CID 140740948
2-ethenylsulfanylpropane-1,3-diol (PubChem CID 140740948) has the molecular formula C5H10O2S and a molecular weight of 134.20 g/mol. Its IUPAC name is 2-ethenylsulfanylpropane-1,3-diol.
| Compound Name | 2-ethenylsulfanylpropane-1,3-diol |
|---|---|
| PubChem CID | 140740948 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 2-ethenylsulfanylpropane-1,3-diol |
| SMILES | C=CSC(CO)CO |
| InChI | InChI=1S/C5H10O2S/c1-2-8-5(3-6)4-7/h2,5-7H,1,3-4H2 |
| InChIKey | VESCDYPXTDKKAN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |