C20H20ClF3N2O2S — CID 22781764
N-[4-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]sulfanylphenyl]pentanamide (PubChem CID 22781764) has the molecular formula C20H20ClF3N2O2S and a molecular weight of 444.91 g/mol. Its IUPAC name is N-[4-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]sulfanylphenyl]pentanamide.
| Compound Name | N-[4-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 22781764 |
| Molecular Formula | C20H20ClF3N2O2S |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N-[4-[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(SCC(=O)Nc2ccc(Cl)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H20ClF3N2O2S/c1-2-3-4-18(27)25-14-6-8-15(9-7-14)29-12-19(28)26-17-10-5-13(21)11-16(17)20(22,23)24/h5-11H,2-4,12H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | KTIJLNFIENSJQV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |