C19H18F4N2O2S — CID 22776241
N-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]pentanamide (PubChem CID 22776241) has the molecular formula C19H18F4N2O2S and a molecular weight of 414.42 g/mol. Its IUPAC name is N-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]pentanamide.
| Compound Name | N-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]pentanamide |
|---|---|
| PubChem CID | 22776241 |
| Molecular Formula | C19H18F4N2O2S |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[4-[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl]sulfanylphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(SCC(=O)Nc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C19H18F4N2O2S/c1-2-3-4-15(26)24-11-5-7-12(8-6-11)28-10-16(27)25-19-17(22)13(20)9-14(21)18(19)23/h5-9H,2-4,10H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | IZGBGBSTQYQCDK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|