C20H20IN3O — CID 22781791
3-iodo-N-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]benzamide (PubChem CID 22781791) has the molecular formula C20H20IN3O and a molecular weight of 445.30 g/mol. Its IUPAC name is 3-iodo-N-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]benzamide.
| Compound Name | 3-iodo-N-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 22781791 |
| Molecular Formula | C20H20IN3O |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | 3-iodo-N-[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]benzamide |
| SMILES | Cc1nn(C)c(C)c1Cc1ccc(NC(=O)c2cccc(I)c2)cc1 |
| InChI | InChI=1S/C20H20IN3O/c1-13-19(14(2)24(3)23-13)11-15-7-9-18(10-8-15)22-20(25)16-5-4-6-17(21)12-16/h4-10,12H,11H2,1-3H3,(H,22,25) |
| InChIKey | VBWVNDAHVWBTRU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|