C22H24N4OS — CID 19630327
4-methyl-N-[[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]carbamothioyl]benzamide (PubChem CID 19630327) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 4-methyl-N-[[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 4-methyl-N-[[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 19630327 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-methyl-N-[[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc(Cc3c(C)nn(C)c3C)cc2)cc1 |
| InChI | InChI=1S/C22H24N4OS/c1-14-5-9-18(10-6-14)21(27)24-22(28)23-19-11-7-17(8-12-19)13-20-15(2)25-26(4)16(20)3/h5-12H,13H2,1-4H3,(H2,23,24,27,28) |
| InChIKey | HGJJQDSPRPCQOU-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|