C25H30N4O2S — CID 22782589
3-butoxy-N-[[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]carbamothioyl]benzamide (PubChem CID 22782589) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is 3-butoxy-N-[[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-butoxy-N-[[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 22782589 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 3-butoxy-N-[[4-[(1,3,5-trimethylpyrazol-4-yl)methyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1cccc(C(=O)NC(=S)Nc2ccc(Cc3c(C)nn(C)c3C)cc2)c1 |
| InChI | InChI=1S/C25H30N4O2S/c1-5-6-14-31-22-9-7-8-20(16-22)24(30)27-25(32)26-21-12-10-19(11-13-21)15-23-17(2)28-29(4)18(23)3/h7-13,16H,5-6,14-15H2,1-4H3,(H2,26,27,30,32) |
| InChIKey | MHVNBMFHLSEPSA-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|