C25H25N3OS2 — CID 22782159
2-(4-aminophenyl)sulfanyl-N-(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide (PubChem CID 22782159) has the molecular formula C25H25N3OS2 and a molecular weight of 447.63 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfanyl-N-(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide.
| Compound Name | 2-(4-aminophenyl)sulfanyl-N-(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide |
|---|---|
| PubChem CID | 22782159 |
| Molecular Formula | C25H25N3OS2 |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-(4-aminophenyl)sulfanyl-N-(3-cyano-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide |
| SMILES | CCC(Sc1ccc(N)cc1)C(=O)Nc1sc2c(c1C#N)CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C25H25N3OS2/c1-2-22(30-19-11-9-18(27)10-12-19)24(29)28-25-21(15-26)20-13-8-17(14-23(20)31-25)16-6-4-3-5-7-16/h3-7,9-12,17,22H,2,8,13-14,27H2,1H3,(H,28,29) |
| InChIKey | SGQMUNPODCNVHD-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|