C27H30N2O3S2 — CID 23099528
ethyl 2-[2-(4-aminophenyl)sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23099528) has the molecular formula C27H30N2O3S2 and a molecular weight of 494.68 g/mol. Its IUPAC name is ethyl 2-[2-(4-aminophenyl)sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-(4-aminophenyl)sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23099528 |
| Molecular Formula | C27H30N2O3S2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | ethyl 2-[2-(4-aminophenyl)sulfanylbutanoylamino]-6-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(CC)Sc2ccc(N)cc2)sc2c1CCC(c1ccccc1)C2 |
| InChI | InChI=1S/C27H30N2O3S2/c1-3-22(33-20-13-11-19(28)12-14-20)25(30)29-26-24(27(31)32-4-2)21-15-10-18(16-23(21)34-26)17-8-6-5-7-9-17/h5-9,11-14,18,22H,3-4,10,15-16,28H2,1-2H3,(H,29,30) |
| InChIKey | YBJCSMJXAZNHQX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|