C23H37NO5 — CID 22792207
7-[(7S,8R,9S)-7-cyano-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid (PubChem CID 22792207) has the molecular formula C23H37NO5 and a molecular weight of 407.55 g/mol. Its IUPAC name is 7-[(7S,8R,9S)-7-cyano-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid.
| Compound Name | 7-[(7S,8R,9S)-7-cyano-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
|---|---|
| PubChem CID | 22792207 |
| Molecular Formula | C23H37NO5 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | 7-[(7S,8R,9S)-7-cyano-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
| SMILES | CCCCCC(=O)CC[C@@H]1[C@@H](C#N)CC2(OCCO2)[C@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C23H37NO5/c1-2-3-6-9-19(25)12-13-20-18(17-24)16-23(28-14-15-29-23)21(20)10-7-4-5-8-11-22(26)27/h18,20-21H,2-16H2,1H3,(H,26,27)/t18-,20-,21+/m1/s1 |
| InChIKey | DZEUXCPVJSKKLG-NRSPTQNISA-N |
| XLogP | 4.86 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|