C23H33NO5 — CID 70610727
(E)-7-[(7R)-7-cyano-8-[(E)-3-oxooct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid (PubChem CID 70610727) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is (E)-7-[(7R)-7-cyano-8-[(E)-3-oxooct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid.
| Compound Name | (E)-7-[(7R)-7-cyano-8-[(E)-3-oxooct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70610727 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (E)-7-[(7R)-7-cyano-8-[(E)-3-oxooct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid |
| SMILES | CCCCCC(=O)/C=C/C1C(C/C=C/CCCC(=O)O)C2(C[C@H]1C#N)OCCO2 |
| InChI | InChI=1S/C23H33NO5/c1-2-3-6-9-19(25)12-13-20-18(17-24)16-23(28-14-15-29-23)21(20)10-7-4-5-8-11-22(26)27/h4,7,12-13,18,20-21H,2-3,5-6,8-11,14-16H2,1H3,(H,26,27)/b7-4+,13-12+/t18-,20?,21?/m0/s1 |
| InChIKey | AIZOCMAQJOPWNT-AFMKBPRDSA-N |
| XLogP | 4.41 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|