C26H19NO5 — CID 2279228
[2-[(Z)-[5-oxo-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzoate (PubChem CID 2279228) has the molecular formula C26H19NO5 and a molecular weight of 425.44 g/mol. Its IUPAC name is [2-[(Z)-[5-oxo-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzoate.
| Compound Name | [2-[(Z)-[5-oxo-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 2279228 |
| Molecular Formula | C26H19NO5 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | [2-[(Z)-[5-oxo-2-[(E)-2-phenylethenyl]-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccccc2/C=C2\N=C(/C=C/c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C26H19NO5/c1-30-21-14-12-19(13-15-21)25(28)31-23-10-6-5-9-20(23)17-22-26(29)32-24(27-22)16-11-18-7-3-2-4-8-18/h2-17H,1H3/b16-11+,22-17- |
| InChIKey | LLVQHHJRMFUPEC-MWDILFQUSA-N |
| XLogP | 4.92 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|