C22H26O5 — CID 22793145
(8S,9S,10R,13S,14S,16S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-8,9,12,14,15,16-hexahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 22793145) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,16S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-8,9,12,14,15,16-hexahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | (8S,9S,10R,13S,14S,16S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-8,9,12,14,15,16-hexahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 22793145 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (8S,9S,10R,13S,14S,16S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-8,9,12,14,15,16-hexahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | C[C@H]1C[C@H]2[C@@H]3C=CC4=CC(=O)C=C[C@]4(C)[C@H]3C(=O)C[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C22H26O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-20(13,2)19(15)17(25)10-21(16,3)22(12,27)18(26)11-23/h4-7,9,12,15-16,19,23,27H,8,10-11H2,1-3H3/t12-,15-,16-,19+,20-,21-,22-/m0/s1 |
| InChIKey | PDYWULYLWMMYDL-RNUIGHNZSA-N |
| XLogP | 1.79 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |