C22H25Cl2FO3 — CID 22793355
(8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-fluoro-17-hydroxy-10,13,16-trimethyl-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22793355) has the molecular formula C22H25Cl2FO3 and a molecular weight of 427.34 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-fluoro-17-hydroxy-10,13,16-trimethyl-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-fluoro-17-hydroxy-10,13,16-trimethyl-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22793355 |
| Molecular Formula | C22H25Cl2FO3 |
| Molecular Weight | 427.34 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,16R,17R)-9-chloro-17-(2-chloroacetyl)-11-fluoro-17-hydroxy-10,13,16-trimethyl-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3C=CC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](F)C[C@]2(C)[C@@]1(O)C(=O)CCl |
| InChI | InChI=1S/C22H25Cl2FO3/c1-12-8-16-15-5-4-13-9-14(26)6-7-19(13,2)21(15,24)17(25)10-20(16,3)22(12,28)18(27)11-23/h4-7,9,12,15-17,28H,8,10-11H2,1-3H3/t12-,15+,16+,17+,19+,20+,21+,22+/m1/s1 |
| InChIKey | LXBACQKSNLRXMX-CXSFZGCWSA-N |
| XLogP | 4.16 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|