C21H23Cl3O3 — CID 22793325
(8S,9R,10S,11S,13S,14S,17R)-9,11-dichloro-17-(2-chloroacetyl)-17-hydroxy-10,13-dimethyl-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22793325) has the molecular formula C21H23Cl3O3 and a molecular weight of 429.77 g/mol. Its IUPAC name is (8S,9R,10S,11S,13S,14S,17R)-9,11-dichloro-17-(2-chloroacetyl)-17-hydroxy-10,13-dimethyl-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9R,10S,11S,13S,14S,17R)-9,11-dichloro-17-(2-chloroacetyl)-17-hydroxy-10,13-dimethyl-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22793325 |
| Molecular Formula | C21H23Cl3O3 |
| Molecular Weight | 429.77 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (8S,9R,10S,11S,13S,14S,17R)-9,11-dichloro-17-(2-chloroacetyl)-17-hydroxy-10,13-dimethyl-8,11,12,14,15,16-hexahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C=CC(=O)C=C1C=C[C@H]1[C@@H]3CC[C@](O)(C(=O)CCl)[C@@]3(C)C[C@H](Cl)[C@@]12Cl |
| InChI | InChI=1S/C21H23Cl3O3/c1-18-7-5-13(25)9-12(18)3-4-15-14-6-8-20(27,17(26)11-22)19(14,2)10-16(23)21(15,18)24/h3-5,7,9,14-16,27H,6,8,10-11H2,1-2H3/t14-,15-,16-,18-,19-,20-,21-/m0/s1 |
| InChIKey | MUHNIDKHWRIJFW-BULBTXNYSA-N |
| XLogP | 4.19 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.77 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|