C24H34BrFO5 — CID 22795561
1-[(1R,2S,5S,6S,10R,12S,13S,16R,18S)-16-bromo-18-hydroxy-5,8,8-trimethyl-7,9,22-trioxahexacyclo[13.5.2.01,16.02,13.05,12.06,10]docosan-6-yl]-2-fluoroethanone (PubChem CID 22795561) has the molecular formula C24H34BrFO5 and a molecular weight of 501.43 g/mol. Its IUPAC name is 1-[(1R,2S,5S,6S,10R,12S,13S,16R,18S)-16-bromo-18-hydroxy-5,8,8-trimethyl-7,9,22-trioxahexacyclo[13.5.2.01,16.02,13.05,12.06,10]docosan-6-yl]-2-fluoroethanone.
| Compound Name | 1-[(1R,2S,5S,6S,10R,12S,13S,16R,18S)-16-bromo-18-hydroxy-5,8,8-trimethyl-7,9,22-trioxahexacyclo[13.5.2.01,16.02,13.05,12.06,10]docosan-6-yl]-2-fluoroethanone |
|---|---|
| PubChem CID | 22795561 |
| Molecular Formula | C24H34BrFO5 |
| Molecular Weight | 501.43 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 1-[(1R,2S,5S,6S,10R,12S,13S,16R,18S)-16-bromo-18-hydroxy-5,8,8-trimethyl-7,9,22-trioxahexacyclo[13.5.2.01,16.02,13.05,12.06,10]docosan-6-yl]-2-fluoroethanone |
| SMILES | CC1(C)O[C@@H]2C[C@H]3[C@@H]4CC5OC[C@@]6(CC[C@H](O)C[C@]56Br)[C@H]4CC[C@]3(C)[C@]2(C(=O)CF)O1 |
| InChI | InChI=1S/C24H34BrFO5/c1-20(2)30-19-9-16-14-8-18-23(25)10-13(27)4-7-22(23,12-29-18)15(14)5-6-21(16,3)24(19,31-20)17(28)11-26/h13-16,18-19,27H,4-12H2,1-3H3/t13-,14+,15-,16-,18?,19+,21-,22-,23-,24+/m0/s1 |
| InChIKey | IOVLOOGWHCTWSS-WIFIGNOASA-N |
| XLogP | 3.94 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|