C23H29FO5 — CID 22795562
(1R,2S,4R,8S,9S,12R,13R,19R,21S)-8-(2-fluoroacetyl)-6,6,9-trimethyl-5,7,20-trioxahexacyclo[10.9.0.02,9.04,8.013,18.019,21]henicos-17-en-16-one (PubChem CID 22795562) has the molecular formula C23H29FO5 and a molecular weight of 404.48 g/mol. Its IUPAC name is (1R,2S,4R,8S,9S,12R,13R,19R,21S)-8-(2-fluoroacetyl)-6,6,9-trimethyl-5,7,20-trioxahexacyclo[10.9.0.02,9.04,8.013,18.019,21]henicos-17-en-16-one.
| Compound Name | (1R,2S,4R,8S,9S,12R,13R,19R,21S)-8-(2-fluoroacetyl)-6,6,9-trimethyl-5,7,20-trioxahexacyclo[10.9.0.02,9.04,8.013,18.019,21]henicos-17-en-16-one |
|---|---|
| PubChem CID | 22795562 |
| Molecular Formula | C23H29FO5 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (1R,2S,4R,8S,9S,12R,13R,19R,21S)-8-(2-fluoroacetyl)-6,6,9-trimethyl-5,7,20-trioxahexacyclo[10.9.0.02,9.04,8.013,18.019,21]henicos-17-en-16-one |
| SMILES | CC1(C)O[C@@H]2C[C@H]3[C@H]4[C@H](CC[C@]3(C)[C@]2(C(=O)CF)O1)[C@H]1CCC(=O)C=C1[C@H]1O[C@@H]41 |
| InChI | InChI=1S/C23H29FO5/c1-21(2)28-17-9-15-18-13(6-7-22(15,3)23(17,29-21)16(26)10-24)12-5-4-11(25)8-14(12)19-20(18)27-19/h8,12-13,15,17-20H,4-7,9-10H2,1-3H3/t12-,13-,15+,17-,18-,19-,20+,22+,23-/m1/s1 |
| InChIKey | OEKISCGGBQXAFJ-GIMBGHAVSA-N |
| XLogP | 3.15 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|