C26H38O2 — CID 22797426
(1S,8S,9S,10R,13S,14S)-1-(cyclohexen-1-yloxymethyl)-13-methyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde (PubChem CID 22797426) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is (1S,8S,9S,10R,13S,14S)-1-(cyclohexen-1-yloxymethyl)-13-methyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde.
| Compound Name | (1S,8S,9S,10R,13S,14S)-1-(cyclohexen-1-yloxymethyl)-13-methyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
|---|---|
| PubChem CID | 22797426 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (1S,8S,9S,10R,13S,14S)-1-(cyclohexen-1-yloxymethyl)-13-methyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CCC3=CCC[C@H](COC4=CCCCC4)[C@]3(C=O)[C@H]1CC2 |
| InChI | InChI=1S/C26H38O2/c1-25-15-6-11-23(25)22-13-12-19-7-5-8-20(17-28-21-9-3-2-4-10-21)26(19,18-27)24(22)14-16-25/h7,9,18,20,22-24H,2-6,8,10-17H2,1H3/t20-,22+,23+,24+,25+,26-/m1/s1 |
| InChIKey | ILBAHZCNWILVKE-BICXVWTRSA-N |
| XLogP | 6.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|