C39H46O3Si — CID 22797448
(1S,7R,8R,9S,10S,13S,14S,17S)-10-(hydroxymethyl)-1,7,13-trimethyl-17-triphenylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 22797448) has the molecular formula C39H46O3Si and a molecular weight of 590.88 g/mol. Its IUPAC name is (1S,7R,8R,9S,10S,13S,14S,17S)-10-(hydroxymethyl)-1,7,13-trimethyl-17-triphenylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (1S,7R,8R,9S,10S,13S,14S,17S)-10-(hydroxymethyl)-1,7,13-trimethyl-17-triphenylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 22797448 |
| Molecular Formula | C39H46O3Si |
| Molecular Weight | 590.88 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | (1S,7R,8R,9S,10S,13S,14S,17S)-10-(hydroxymethyl)-1,7,13-trimethyl-17-triphenylsilyloxy-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@@H]1CC2=CC(=O)C[C@H](C)[C@]2(CO)[C@H]2CC[C@]3(C)[C@@H](O[Si](c4ccccc4)(c4ccccc4)c4ccccc4)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C39H46O3Si/c1-27-23-29-25-30(41)24-28(2)39(29,26-40)35-21-22-38(3)34(37(27)35)19-20-36(38)42-43(31-13-7-4-8-14-31,32-15-9-5-10-16-32)33-17-11-6-12-18-33/h4-18,25,27-28,34-37,40H,19-24,26H2,1-3H3/t27-,28+,34+,35+,36+,37+,38+,39+/m1/s1 |
| InChIKey | VOZNJFSHTYSSIL-XUYVSUIESA-N |
| XLogP | 6.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.88 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|