C19H20N4O4S — CID 22797873
N-[(5S)-2-(4,6-dioxo-1H-pyrimidin-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide (PubChem CID 22797873) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[(5S)-2-(4,6-dioxo-1H-pyrimidin-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide.
| Compound Name | N-[(5S)-2-(4,6-dioxo-1H-pyrimidin-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide |
|---|---|
| PubChem CID | 22797873 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | N-[(5S)-2-(4,6-dioxo-1H-pyrimidin-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptan-6-yl]-2-phenylacetamide |
| SMILES | CC1(C)S[C@H]2C(NC(=O)Cc3ccccc3)C(=O)N2C1C1=NC(=O)CC(=O)N1 |
| InChI | InChI=1S/C19H20N4O4S/c1-19(2)15(16-21-12(25)9-13(26)22-16)23-17(27)14(18(23)28-19)20-11(24)8-10-6-4-3-5-7-10/h3-7,14-15,18H,8-9H2,1-2H3,(H,20,24)(H,21,22,25,26)/t14?,15?,18-/m0/s1 |
| InChIKey | UFHILLGZQOMUKB-JMLCCBQJSA-N |
| XLogP | 0.22 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|