C25H30ClFO7 — CID 22806131
chloromethyl (7S,8R,9R,10S,11S,13S,14S,17S)-9-fluoro-7,11-dihydroxy-10,13-dimethyl-16-methylidene-3-oxo-17-propanoyloxy-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 22806131) has the molecular formula C25H30ClFO7 and a molecular weight of 496.96 g/mol. Its IUPAC name is chloromethyl (7S,8R,9R,10S,11S,13S,14S,17S)-9-fluoro-7,11-dihydroxy-10,13-dimethyl-16-methylidene-3-oxo-17-propanoyloxy-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | chloromethyl (7S,8R,9R,10S,11S,13S,14S,17S)-9-fluoro-7,11-dihydroxy-10,13-dimethyl-16-methylidene-3-oxo-17-propanoyloxy-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 22806131 |
| Molecular Formula | C25H30ClFO7 |
| Molecular Weight | 496.96 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | chloromethyl (7S,8R,9R,10S,11S,13S,14S,17S)-9-fluoro-7,11-dihydroxy-10,13-dimethyl-16-methylidene-3-oxo-17-propanoyloxy-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | C=C1C[C@H]2[C@@H]3[C@@H](O)CC4=CC(=O)C=C[C@]4(C)[C@@]3(F)[C@@H](O)C[C@]2(C)[C@]1(OC(=O)CC)C(=O)OCCl |
| InChI | InChI=1S/C25H30ClFO7/c1-5-19(31)34-25(21(32)33-12-26)13(2)8-16-20-17(29)10-14-9-15(28)6-7-22(14,3)24(20,27)18(30)11-23(16,25)4/h6-7,9,16-18,20,29-30H,2,5,8,10-12H2,1,3-4H3/t16-,17-,18-,20+,22-,23-,24+,25+/m0/s1 |
| InChIKey | XFEBITNLYMSXSX-XXKSOITISA-N |
| XLogP | 2.93 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.96 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|