C25H28Cl3FO4 — CID 22806029
[(7R,8R,9R,10S,11S,13S,14S,17S)-7,9,11-trichloro-17-(2-fluoroacetyl)-10,13-dimethyl-16-methylidene-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 22806029) has the molecular formula C25H28Cl3FO4 and a molecular weight of 517.85 g/mol. Its IUPAC name is [(7R,8R,9R,10S,11S,13S,14S,17S)-7,9,11-trichloro-17-(2-fluoroacetyl)-10,13-dimethyl-16-methylidene-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(7R,8R,9R,10S,11S,13S,14S,17S)-7,9,11-trichloro-17-(2-fluoroacetyl)-10,13-dimethyl-16-methylidene-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 22806029 |
| Molecular Formula | C25H28Cl3FO4 |
| Molecular Weight | 517.85 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | [(7R,8R,9R,10S,11S,13S,14S,17S)-7,9,11-trichloro-17-(2-fluoroacetyl)-10,13-dimethyl-16-methylidene-3-oxo-7,8,11,12,14,15-hexahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | C=C1C[C@H]2[C@@H]3[C@H](Cl)CC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](Cl)C[C@]2(C)[C@]1(OC(=O)CC)C(=O)CF |
| InChI | InChI=1S/C25H28Cl3FO4/c1-5-20(32)33-25(19(31)12-29)13(2)8-16-21-17(26)10-14-9-15(30)6-7-22(14,3)24(21,28)18(27)11-23(16,25)4/h6-7,9,16-18,21H,2,5,8,10-12H2,1,3-4H3/t16-,17+,18-,21+,22-,23-,24+,25+/m0/s1 |
| InChIKey | CGFLZVSHDRDEEH-RPOHODPTSA-N |
| XLogP | 5.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.85 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|