C24H30ClFO5 — CID 88802364
[(8S,9S,10R,13S,14S,17R)-7-chloro-17-(2-fluoroacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 88802364) has the molecular formula C24H30ClFO5 and a molecular weight of 452.95 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-7-chloro-17-(2-fluoroacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-7-chloro-17-(2-fluoroacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 88802364 |
| Molecular Formula | C24H30ClFO5 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-7-chloro-17-(2-fluoroacetyl)-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@]1(C(=O)CF)CC[C@H]2[C@@H]3C(Cl)CC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C24H30ClFO5/c1-4-19(30)31-24(18(29)12-26)8-6-15-20-16(25)10-13-9-14(27)5-7-22(13,2)21(20)17(28)11-23(15,24)3/h5,7,9,15-17,20-21,28H,4,6,8,10-12H2,1-3H3/t15-,16?,17?,20+,21-,22-,23-,24-/m0/s1 |
| InChIKey | JZSFLDPSDLHYAK-OBSAJMADSA-N |
| XLogP | 3.71 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|