C19H30O5 — CID 22807699
1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 22807699) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethanol.
| Compound Name | 1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethanol |
|---|---|
| PubChem CID | 22807699 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-(2,5-dimethoxy-3,4,6-trimethylphenyl)-2-[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | COc1c(C)c(C)c(OC)c(C(O)C[C@@]2(C)COC(C)(C)O2)c1C |
| InChI | InChI=1S/C19H30O5/c1-11-12(2)17(22-8)15(13(3)16(11)21-7)14(20)9-19(6)10-23-18(4,5)24-19/h14,20H,9-10H2,1-8H3/t14?,19-/m0/s1 |
| InChIKey | GWBYYNOVVXVVKQ-PKDNWHCCSA-N |
| XLogP | 3.59 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |