C17H27N2O5PS — CID 22811645
[1-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-methylsulfanylpropyl]phosphonous acid (PubChem CID 22811645) has the molecular formula C17H27N2O5PS and a molecular weight of 402.45 g/mol. Its IUPAC name is [1-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-methylsulfanylpropyl]phosphonous acid.
| Compound Name | [1-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-methylsulfanylpropyl]phosphonous acid |
|---|---|
| PubChem CID | 22811645 |
| Molecular Formula | C17H27N2O5PS |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [1-[[(2S)-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-3-methylsulfanylpropyl]phosphonous acid |
| SMILES | CSCCC(NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)P(O)O |
| InChI | InChI=1S/C17H27N2O5PS/c1-12(2)15(16(20)18-14(25(22)23)9-10-26-3)19-17(21)24-11-13-7-5-4-6-8-13/h4-8,12,14-15,22-23H,9-11H2,1-3H3,(H,18,20)(H,19,21)/t14?,15-/m0/s1 |
| InChIKey | RMGDHVHIXRCRQU-LOACHALJSA-N |
| XLogP | 2.43 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|