C22H21ClN2O5S — CID 22812295
benzyl (2R)-3-(4-acetamidophenyl)sulfinyl-3-chloro-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22812295) has the molecular formula C22H21ClN2O5S and a molecular weight of 460.94 g/mol. Its IUPAC name is benzyl (2R)-3-(4-acetamidophenyl)sulfinyl-3-chloro-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (2R)-3-(4-acetamidophenyl)sulfinyl-3-chloro-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22812295 |
| Molecular Formula | C22H21ClN2O5S |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | benzyl (2R)-3-(4-acetamidophenyl)sulfinyl-3-chloro-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(S(=O)C2(Cl)CC3CC(=O)N3[C@@H]2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H21ClN2O5S/c1-14(26)24-16-7-9-18(10-8-16)31(29)22(23)12-17-11-19(27)25(17)20(22)21(28)30-13-15-5-3-2-4-6-15/h2-10,17,20H,11-13H2,1H3,(H,24,26)/t17?,20-,22?,31?/m1/s1 |
| InChIKey | MZMCUDXZKKYXIH-ZBGIUFNCSA-N |
| XLogP | 2.80 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|