C25H24ClNO6S — CID 54378895
benzyl 3-(benzenesulfinyl)-3-chloro-6-(4-methoxy-4-oxobut-2-enyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 54378895) has the molecular formula C25H24ClNO6S and a molecular weight of 501.99 g/mol. Its IUPAC name is benzyl 3-(benzenesulfinyl)-3-chloro-6-(4-methoxy-4-oxobut-2-enyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl 3-(benzenesulfinyl)-3-chloro-6-(4-methoxy-4-oxobut-2-enyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 54378895 |
| Molecular Formula | C25H24ClNO6S |
| Molecular Weight | 501.99 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | benzyl 3-(benzenesulfinyl)-3-chloro-6-(4-methoxy-4-oxobut-2-enyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)C=CCC1C(=O)N2C1CC(Cl)(S(=O)c1ccccc1)C2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H24ClNO6S/c1-32-21(28)14-8-13-19-20-15-25(26,34(31)18-11-6-3-7-12-18)22(27(20)23(19)29)24(30)33-16-17-9-4-2-5-10-17/h2-12,14,19-20,22H,13,15-16H2,1H3 |
| InChIKey | UYNBQAYBHCNXAJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.99 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|