benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate

C21H21NO3 — CID 70516157

IUPACbenzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate
SMILESO=C(OCc1ccccc1)C1CCC2C(Cc3ccccc3)C(=O)N12
InChIInChI=1S/C21H21NO3/c23-20-17(13-15-7-3-1-4-8-15)18-11-12-19(22(18)20)21(24)25-14-16-9-5-2-6-10-16/h1-10,17-19H,11-14H2
InChIKeyRFAZUCFNWBVWJS-UHFFFAOYSA-N
MW335.40 g/mol
LogP2.96
Rot. Bonds5

About benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate

benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70516157) has the molecular formula C21H21NO3 and a molecular weight of 335.40 g/mol. Its IUPAC name is benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.

Molecular Properties

Compound Namebenzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate
PubChem CID70516157
Molecular FormulaC21H21NO3
Molecular Weight335.40 g/mol
Exact Mass335.15
IUPAC Namebenzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate
SMILESO=C(OCc1ccccc1)C1CCC2C(Cc3ccccc3)C(=O)N12
InChIInChI=1S/C21H21NO3/c23-20-17(13-15-7-3-1-4-8-15)18-11-12-19(22(18)20)21(24)25-14-16-9-5-2-6-10-16/h1-10,17-19H,11-14H2
InChIKeyRFAZUCFNWBVWJS-UHFFFAOYSA-N
XLogP2.96
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.40
LogP ≤ 52.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate?
The IUPAC name of benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate (CID 70516157) is benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate.
What is the SMILES notation for benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate?
The canonical SMILES for benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate is O=C(OCc1ccccc1)C1CCC2C(Cc3ccccc3)C(=O)N12.
What is the InChIKey of benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate?
The InChIKey is RFAZUCFNWBVWJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO3/c23-20-17(13-15-7-3-1-4-8-15)18-11-12-19(22(18)20)21(24)25-14-16-9-5-2-6-10-16/h1-10,17-19H,11-14H2.
What are the key properties of benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate?
benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate has a molecular weight of 335.40 g/mol, XLogP of 2.96, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 6-benzyl-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylate is sourced from PubChem (CID 70516157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).