C25H25NO5S — CID 20526337
benzyl 6-[(E)-4-methoxy-4-oxobut-2-enyl]-7-oxo-3-phenylsulfanyl-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 20526337) has the molecular formula C25H25NO5S and a molecular weight of 451.54 g/mol. Its IUPAC name is benzyl 6-[(E)-4-methoxy-4-oxobut-2-enyl]-7-oxo-3-phenylsulfanyl-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl 6-[(E)-4-methoxy-4-oxobut-2-enyl]-7-oxo-3-phenylsulfanyl-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 20526337 |
| Molecular Formula | C25H25NO5S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | benzyl 6-[(E)-4-methoxy-4-oxobut-2-enyl]-7-oxo-3-phenylsulfanyl-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)/C=C/CC1C(=O)N2C1CC(Sc1ccccc1)C2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H25NO5S/c1-30-22(27)14-8-13-19-20-15-21(32-18-11-6-3-7-12-18)23(26(20)24(19)28)25(29)31-16-17-9-4-2-5-10-17/h2-12,14,19-21,23H,13,15-16H2,1H3/b14-8+ |
| InChIKey | LLAMGAJSXLIQHJ-RIYZIHGNSA-N |
| XLogP | 3.61 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|