C22H34O4 — CID 22813114
7-[(1R,2R,3R)-2-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3-methyl-5-oxocyclopentyl]heptanoic acid (PubChem CID 22813114) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-2-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3-methyl-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,3R)-2-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3-methyl-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 22813114 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 7-[(1R,2R,3R)-2-[(E,3S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3-methyl-5-oxocyclopentyl]heptanoic acid |
| SMILES | CC#CCC(C)[C@H](O)/C=C/[C@H]1[C@H](C)CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H34O4/c1-4-5-10-16(2)20(23)14-13-18-17(3)15-21(24)19(18)11-8-6-7-9-12-22(25)26/h13-14,16-20,23H,6-12,15H2,1-3H3,(H,25,26)/b14-13+/t16?,17-,18+,19-,20-/m1/s1 |
| InChIKey | OQAWIKRUHZTFHX-ZFWCEFETSA-N |
| XLogP | 4.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|