C22H35FO6 — CID 22813298
(2R,3aR,4S,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-2-(5-methoxy-5-oxopentyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid (PubChem CID 22813298) has the molecular formula C22H35FO6 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2R,3aR,4S,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-2-(5-methoxy-5-oxopentyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid.
| Compound Name | (2R,3aR,4S,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-2-(5-methoxy-5-oxopentyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid |
|---|---|
| PubChem CID | 22813298 |
| Molecular Formula | C22H35FO6 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2R,3aR,4S,6aS)-4-[(E,3R,4R)-4-fluoro-3-hydroxyoct-1-enyl]-2-(5-methoxy-5-oxopentyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-5-carboxylic acid |
| SMILES | CCCC[C@@H](F)[C@H](O)/C=C/[C@@H]1C(C(=O)O)C[C@@H]2O[C@H](CCCCC(=O)OC)C[C@@H]21 |
| InChI | InChI=1S/C22H35FO6/c1-3-4-8-18(23)19(24)11-10-15-16-12-14(7-5-6-9-21(25)28-2)29-20(16)13-17(15)22(26)27/h10-11,14-20,24H,3-9,12-13H2,1-2H3,(H,26,27)/b11-10+/t14-,15+,16-,17?,18-,19-,20+/m1/s1 |
| InChIKey | OCXHQNHGVDPKMT-ZWPWUSAQSA-N |
| XLogP | 3.66 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|