C23H21NO5 — CID 22817592
(2S)-4-hydroxy-4-naphthalen-2-yl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (PubChem CID 22817592) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is (2S)-4-hydroxy-4-naphthalen-2-yl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-hydroxy-4-naphthalen-2-yl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22817592 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | (2S)-4-hydroxy-4-naphthalen-2-yl-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CC(O)(c2ccc3ccccc3c2)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H21NO5/c25-21(26)20-13-23(28,19-11-10-17-8-4-5-9-18(17)12-19)15-24(20)22(27)29-14-16-6-2-1-3-7-16/h1-12,20,28H,13-15H2,(H,25,26)/t20-,23?/m0/s1 |
| InChIKey | YFGBDYFAPBILHS-AJZOCDQUSA-N |
| XLogP | 3.52 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |