C26H36O6 — CID 22820075
methyl 7-[(1R,2S,3S)-3-hydroxy-2-[(3S)-3-hydroxy-5-(4-methoxyphenyl)-3-methylpent-1-ynyl]-5-oxocyclopentyl]heptanoate (PubChem CID 22820075) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is methyl 7-[(1R,2S,3S)-3-hydroxy-2-[(3S)-3-hydroxy-5-(4-methoxyphenyl)-3-methylpent-1-ynyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,3S)-3-hydroxy-2-[(3S)-3-hydroxy-5-(4-methoxyphenyl)-3-methylpent-1-ynyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 22820075 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | methyl 7-[(1R,2S,3S)-3-hydroxy-2-[(3S)-3-hydroxy-5-(4-methoxyphenyl)-3-methylpent-1-ynyl]-5-oxocyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@H]1C(=O)C[C@H](O)[C@@H]1C#C[C@@](C)(O)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C26H36O6/c1-26(30,16-14-19-10-12-20(31-2)13-11-19)17-15-22-21(23(27)18-24(22)28)8-6-4-5-7-9-25(29)32-3/h10-13,21-22,24,28,30H,4-9,14,16,18H2,1-3H3/t21-,22-,24+,26+/m1/s1 |
| InChIKey | JTAUYFKYDYCMRO-IDKQNPPTSA-N |
| XLogP | 3.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|