C25H45N7O7S — CID 22823069
(2S)-2-[[(2S)-2-[[2-[[2-[[2-(acetylsulfanylmethyl)-4-methylpentanoyl]amino]acetyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 22823069) has the molecular formula C25H45N7O7S and a molecular weight of 587.74 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[[2-[[2-(acetylsulfanylmethyl)-4-methylpentanoyl]amino]acetyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[[2-[[2-(acetylsulfanylmethyl)-4-methylpentanoyl]amino]acetyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 22823069 |
| Molecular Formula | C25H45N7O7S |
| Molecular Weight | 587.74 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[[2-[[2-(acetylsulfanylmethyl)-4-methylpentanoyl]amino]acetyl]amino]acetyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(=O)SCC(CC(C)C)C(=O)NCC(=O)NCC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C25H45N7O7S/c1-14(2)9-17(13-40-16(5)33)22(36)30-11-20(34)29-12-21(35)31-19(10-15(3)4)23(37)32-18(24(38)39)7-6-8-28-25(26)27/h14-15,17-19H,6-13H2,1-5H3,(H,29,34)(H,30,36)(H,31,35)(H,32,37)(H,38,39)(H4,26,27,28)/t17?,18-,19-/m0/s1 |
| InChIKey | MNYSMTURWDFGSU-MNNMKWMVSA-N |
| XLogP | -0.69 |
| TPSA | 235.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.74 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|