C11H21NO8 — CID 22824281
tert-butyl N-[(2S,3S,4R)-1,2,3,4,6-pentahydroxy-5-oxohexyl]carbamate (PubChem CID 22824281) has the molecular formula C11H21NO8 and a molecular weight of 295.29 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4R)-1,2,3,4,6-pentahydroxy-5-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4R)-1,2,3,4,6-pentahydroxy-5-oxohexyl]carbamate |
|---|---|
| PubChem CID | 22824281 |
| Molecular Formula | C11H21NO8 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | tert-butyl N-[(2S,3S,4R)-1,2,3,4,6-pentahydroxy-5-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)CO |
| InChI | InChI=1S/C11H21NO8/c1-11(2,3)20-10(19)12-9(18)8(17)7(16)6(15)5(14)4-13/h6-9,13,15-18H,4H2,1-3H3,(H,12,19)/t6-,7+,8-,9?/m0/s1 |
| InChIKey | PTZTUINZFIXZAE-KRBWIIOGSA-N |
| XLogP | -2.53 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|