C21H35N — CID 22825773
4-[(4aR,8aS)-8a-butyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]cyclohexane-1-carbonitrile (PubChem CID 22825773) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is 4-[(4aR,8aS)-8a-butyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]cyclohexane-1-carbonitrile.
| Compound Name | 4-[(4aR,8aS)-8a-butyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 22825773 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 4-[(4aR,8aS)-8a-butyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]cyclohexane-1-carbonitrile |
| SMILES | CCCC[C@]12CCCC[C@@H]1CCCC2C1CCC(C#N)CC1 |
| InChI | InChI=1S/C21H35N/c1-2-3-14-21-15-5-4-7-19(21)8-6-9-20(21)18-12-10-17(16-22)11-13-18/h17-20H,2-15H2,1H3/t17?,18?,19-,20?,21+/m1/s1 |
| InChIKey | DHZKLNIXCLBJSK-OFQZUOMCSA-N |
| XLogP | 6.48 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |