C11H18 — CID 548931
1,1a,2,3,4,4a,5,6,7,8-decahydrocyclopropa[j]naphthalene (PubChem CID 548931) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 1,1a,2,3,4,4a,5,6,7,8-decahydrocyclopropa[j]naphthalene.
| Compound Name | 1,1a,2,3,4,4a,5,6,7,8-decahydrocyclopropa[j]naphthalene |
|---|---|
| PubChem CID | 548931 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 1,1a,2,3,4,4a,5,6,7,8-decahydrocyclopropa[j]naphthalene |
| SMILES | C1CCC23CC2CCCC3C1 |
| InChI | InChI=1S/C11H18/c1-2-7-11-8-10(11)6-3-5-9(11)4-1/h9-10H,1-8H2 |
| InChIKey | FNQSFHJONXSIKP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |