C16H21N2O9P — CID 22826708
2-[hydroxy-[(2S,3R)-3-methyloxiran-2-yl]oxyphosphoryl]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid (PubChem CID 22826708) has the molecular formula C16H21N2O9P and a molecular weight of 416.32 g/mol. Its IUPAC name is 2-[hydroxy-[(2S,3R)-3-methyloxiran-2-yl]oxyphosphoryl]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid.
| Compound Name | 2-[hydroxy-[(2S,3R)-3-methyloxiran-2-yl]oxyphosphoryl]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22826708 |
| Molecular Formula | C16H21N2O9P |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2-[hydroxy-[(2S,3R)-3-methyloxiran-2-yl]oxyphosphoryl]-2-[[(2S)-2-(phenylmethoxycarbonylamino)propanoyl]amino]acetic acid |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)C(=O)NC(C(=O)O)P(=O)(O)O[C@@H]1O[C@@H]1C |
| InChI | InChI=1S/C16H21N2O9P/c1-9(17-16(22)25-8-11-6-4-3-5-7-11)12(19)18-13(14(20)21)28(23,24)27-15-10(2)26-15/h3-7,9-10,13,15H,8H2,1-2H3,(H,17,22)(H,18,19)(H,20,21)(H,23,24)/t9-,10+,13?,15-/m0/s1 |
| InChIKey | MKWHTSFZYFDYRE-WHUVUMJISA-N |
| XLogP | 0.77 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|