C19H15ClN4O4S2 — CID 2282880
3-chloro-4-ethoxy-N-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide (PubChem CID 2282880) has the molecular formula C19H15ClN4O4S2 and a molecular weight of 462.94 g/mol. Its IUPAC name is 3-chloro-4-ethoxy-N-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-4-ethoxy-N-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2282880 |
| Molecular Formula | C19H15ClN4O4S2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 3-chloro-4-ethoxy-N-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1Cl |
| InChI | InChI=1S/C19H15ClN4O4S2/c1-2-28-16-7-6-12(9-14(16)20)17(25)22-18(29)23-19-21-15(10-30-19)11-4-3-5-13(8-11)24(26)27/h3-10H,2H2,1H3,(H2,21,22,23,25,29) |
| InChIKey | KUMHSCTUDMVUAC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|