C14H16N2O6 — CID 22839137
(2S)-2-amino-4-[[(1S)-1-carboxy-2-phenylethyl]-formylamino]-4-oxobutanoic acid (PubChem CID 22839137) has the molecular formula C14H16N2O6 and a molecular weight of 308.29 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(1S)-1-carboxy-2-phenylethyl]-formylamino]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[[(1S)-1-carboxy-2-phenylethyl]-formylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22839137 |
| Molecular Formula | C14H16N2O6 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2S)-2-amino-4-[[(1S)-1-carboxy-2-phenylethyl]-formylamino]-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)N(C=O)[C@@H](Cc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H16N2O6/c15-10(13(19)20)7-12(18)16(8-17)11(14(21)22)6-9-4-2-1-3-5-9/h1-5,8,10-11H,6-7,15H2,(H,19,20)(H,21,22)/t10-,11-/m0/s1 |
| InChIKey | AQGGLWFHRWFLKF-QWRGUYRKSA-N |
| XLogP | -0.53 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|