About (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde
(2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde (PubChem CID 87600839) has the molecular formula C11H14ClNO3
and a molecular weight of 243.69 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde.
Molecular Properties
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde |
| PubChem CID | 87600839 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.O=CCCl |
| InChI | InChI=1S/C9H11NO2.C2H3ClO/c10-8(9(11)12)6-7-4-2-1-3-5-7;3-1-2-4/h1-5,8H,6,10H2,(H,11,12);2H,1H2/t8-;/m0./s1 |
| InChIKey | SDKRLUNOCWAXNJ-QRPNPIFTSA-N |
| XLogP | 1.07 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde?
The IUPAC name of (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde (CID 87600839) is (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde.
What is the SMILES notation for (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde?
The canonical SMILES for (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde is N[C@@H](Cc1ccccc1)C(=O)O.O=CCCl.
What is the InChIKey of (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde?
The InChIKey is SDKRLUNOCWAXNJ-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H11NO2.C2H3ClO/c10-8(9(11)12)6-7-4-2-1-3-5-7;3-1-2-4/h1-5,8H,6,10H2,(H,11,12);2H,1H2/t8-;/m0./s1.
What are the key properties of (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde?
(2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde has a molecular weight of 243.69 g/mol, XLogP of 1.07, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-phenylpropanoic acid;2-chloroacetaldehyde is sourced from PubChem (CID 87600839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).