C29H36O2 — CID 22844089
[(8R,9R,10S,13S,14S,17R)-17-ethynyl-13-methyl-4,5,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-phenylpropanoate (PubChem CID 22844089) has the molecular formula C29H36O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S,17R)-17-ethynyl-13-methyl-4,5,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-phenylpropanoate.
| Compound Name | [(8R,9R,10S,13S,14S,17R)-17-ethynyl-13-methyl-4,5,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 22844089 |
| Molecular Formula | C29H36O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | [(8R,9R,10S,13S,14S,17R)-17-ethynyl-13-methyl-4,5,6,7,8,9,10,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] 3-phenylpropanoate |
| SMILES | C#C[C@]1(OC(=O)CCc2ccccc2)CC[C@H]2[C@@H]3CCC4CC=CC[C@@H]4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C29H36O2/c1-3-29(31-27(30)16-13-21-9-5-4-6-10-21)20-18-26-25-15-14-22-11-7-8-12-23(22)24(25)17-19-28(26,29)2/h1,4-10,22-26H,11-20H2,2H3/t22?,23-,24+,25+,26-,28-,29-/m0/s1 |
| InChIKey | LOTCICQWAAJYML-HNBJZWIVSA-N |
| XLogP | 6.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|