C10H14N2O4 — CID 22848160
(2S,4S)-2-amino-4-(2-amino-3-hydroxyphenyl)-4-hydroxybutanoic acid (PubChem CID 22848160) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is (2S,4S)-2-amino-4-(2-amino-3-hydroxyphenyl)-4-hydroxybutanoic acid.
| Compound Name | (2S,4S)-2-amino-4-(2-amino-3-hydroxyphenyl)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22848160 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | (2S,4S)-2-amino-4-(2-amino-3-hydroxyphenyl)-4-hydroxybutanoic acid |
| SMILES | Nc1c(O)cccc1[C@@H](O)C[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H14N2O4/c11-6(10(15)16)4-8(14)5-2-1-3-7(13)9(5)12/h1-3,6,8,13-14H,4,11-12H2,(H,15,16)/t6-,8-/m0/s1 |
| InChIKey | VOUACZWCAPHKMW-XPUUQOCRSA-N |
| XLogP | -0.19 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|