C16H26O2 — CID 22848924
(2S,3R)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-5-methyloxan-3-ol (PubChem CID 22848924) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (2S,3R)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-5-methyloxan-3-ol.
| Compound Name | (2S,3R)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-5-methyloxan-3-ol |
|---|---|
| PubChem CID | 22848924 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (2S,3R)-2-[(2E,4E,6E)-deca-2,4,6-trien-2-yl]-5-methyloxan-3-ol |
| SMILES | CCC/C=C/C=C/C=C(\C)[C@@H]1OCC(C)C[C@H]1O |
| InChI | InChI=1S/C16H26O2/c1-4-5-6-7-8-9-10-14(3)16-15(17)11-13(2)12-18-16/h6-10,13,15-17H,4-5,11-12H2,1-3H3/b7-6+,9-8+,14-10+/t13?,15-,16+/m1/s1 |
| InChIKey | SODFVLMJIKVYJO-LYCKBVCQSA-N |
| XLogP | 3.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|