C11H16O2 — CID 54490128
2-methyldeca-2,4,6-trienoic acid (PubChem CID 54490128) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methyldeca-2,4,6-trienoic acid.
| Compound Name | 2-methyldeca-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 54490128 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-methyldeca-2,4,6-trienoic acid |
| SMILES | CCCC=CC=CC=C(C)C(=O)O |
| InChI | InChI=1S/C11H16O2/c1-3-4-5-6-7-8-9-10(2)11(12)13/h5-9H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | XVCMHUKQXDGZIU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|