2-methyldeca-2,4,6-trienoic acid

C11H16O2 — CID 54490128

IUPAC2-methyldeca-2,4,6-trienoic acid
SMILESCCCC=CC=CC=C(C)C(=O)O
InChIInChI=1S/C11H16O2/c1-3-4-5-6-7-8-9-10(2)11(12)13/h5-9H,3-4H2,1-2H3,(H,12,13)
InChIKeyXVCMHUKQXDGZIU-UHFFFAOYSA-N
MW180.25 g/mol
LogP2.93
Rot. Bonds5

About 2-methyldeca-2,4,6-trienoic acid

2-methyldeca-2,4,6-trienoic acid (PubChem CID 54490128) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methyldeca-2,4,6-trienoic acid.

Molecular Properties

Compound Name2-methyldeca-2,4,6-trienoic acid
PubChem CID54490128
Molecular FormulaC11H16O2
Molecular Weight180.25 g/mol
Exact Mass180.12
IUPAC Name2-methyldeca-2,4,6-trienoic acid
SMILESCCCC=CC=CC=C(C)C(=O)O
InChIInChI=1S/C11H16O2/c1-3-4-5-6-7-8-9-10(2)11(12)13/h5-9H,3-4H2,1-2H3,(H,12,13)
InChIKeyXVCMHUKQXDGZIU-UHFFFAOYSA-N
XLogP2.93
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.25
LogP ≤ 52.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-methyldeca-2,4,6-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyldeca-2,4,6-trienoic acid?
The IUPAC name of 2-methyldeca-2,4,6-trienoic acid (CID 54490128) is 2-methyldeca-2,4,6-trienoic acid.
What is the SMILES notation for 2-methyldeca-2,4,6-trienoic acid?
The canonical SMILES for 2-methyldeca-2,4,6-trienoic acid is CCCC=CC=CC=C(C)C(=O)O.
What is the InChIKey of 2-methyldeca-2,4,6-trienoic acid?
The InChIKey is XVCMHUKQXDGZIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-3-4-5-6-7-8-9-10(2)11(12)13/h5-9H,3-4H2,1-2H3,(H,12,13).
What are the key properties of 2-methyldeca-2,4,6-trienoic acid?
2-methyldeca-2,4,6-trienoic acid has a molecular weight of 180.25 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldeca-2,4,6-trienoic acid is sourced from PubChem (CID 54490128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).