C13H20O4 — CID 51693043
(1R,2R,3S,5S)-5-[(1E,3E)-hepta-1,3-dienyl]-2,3-dihydroxycyclopentane-1-carboxylic acid (PubChem CID 51693043) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1R,2R,3S,5S)-5-[(1E,3E)-hepta-1,3-dienyl]-2,3-dihydroxycyclopentane-1-carboxylic acid.
| Compound Name | (1R,2R,3S,5S)-5-[(1E,3E)-hepta-1,3-dienyl]-2,3-dihydroxycyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 51693043 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (1R,2R,3S,5S)-5-[(1E,3E)-hepta-1,3-dienyl]-2,3-dihydroxycyclopentane-1-carboxylic acid |
| SMILES | CCC/C=C/C=C/[C@@H]1C[C@H](O)[C@H](O)[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H20O4/c1-2-3-4-5-6-7-9-8-10(14)12(15)11(9)13(16)17/h4-7,9-12,14-15H,2-3,8H2,1H3,(H,16,17)/b5-4+,7-6+/t9-,10+,11-,12+/m1/s1 |
| InChIKey | QNHUKXZHEMSPPA-VSUPOFTBSA-N |
| XLogP | 1.34 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|