C19H34N2O5 — CID 22849620
tert-butyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 22849620) has the molecular formula C19H34N2O5 and a molecular weight of 370.49 g/mol. Its IUPAC name is tert-butyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylprop-2-enoylamino)hexanoate.
| Compound Name | tert-butyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylprop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 22849620 |
| Molecular Formula | C19H34N2O5 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | tert-butyl (2S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H34N2O5/c1-13(2)15(22)21-14(16(23)25-18(3,4)5)11-9-10-12-20-17(24)26-19(6,7)8/h14H,1,9-12H2,2-8H3,(H,20,24)(H,21,22)/t14-/m0/s1 |
| InChIKey | BJBXHKAGWKYKAI-AWEZNQCLSA-N |
| XLogP | 3.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|