C29H39NO4 — CID 22849888
(3-tert-butylphenyl) (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-4,7-dioxo-2,3,3a,3b,5,5a,6,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxylate (PubChem CID 22849888) has the molecular formula C29H39NO4 and a molecular weight of 465.63 g/mol. Its IUPAC name is (3-tert-butylphenyl) (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-4,7-dioxo-2,3,3a,3b,5,5a,6,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxylate.
| Compound Name | (3-tert-butylphenyl) (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-4,7-dioxo-2,3,3a,3b,5,5a,6,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 22849888 |
| Molecular Formula | C29H39NO4 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | (3-tert-butylphenyl) (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-4,7-dioxo-2,3,3a,3b,5,5a,6,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxylate |
| SMILES | CC(C)(C)c1cccc(OC(=O)[C@H]2CC[C@H]3[C@@H]4C(=O)C[C@H]5NC(=O)CC[C@]5(C)[C@H]4CC[C@]23C)c1 |
| InChI | InChI=1S/C29H39NO4/c1-27(2,3)17-7-6-8-18(15-17)34-26(33)21-10-9-19-25-20(11-13-28(19,21)4)29(5)14-12-24(32)30-23(29)16-22(25)31/h6-8,15,19-21,23,25H,9-14,16H2,1-5H3,(H,30,32)/t19-,20-,21+,23+,25-,28-,29+/m0/s1 |
| InChIKey | GNQQMSFUPFRZKF-RFTITBRFSA-N |
| XLogP | 5.21 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|